C29H26N2O3 — CID 123780890
N-[[2-[2-[2-(4-hydroxyphenyl)ethenyl]phenyl]phenyl]methyl]-2-(6-methoxy-3-pyridinyl)acetamide (PubChem CID 123780890) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[[2-[2-[2-(4-hydroxyphenyl)ethenyl]phenyl]phenyl]methyl]-2-(6-methoxy-3-pyridinyl)acetamide.
| Compound Name | N-[[2-[2-[2-(4-hydroxyphenyl)ethenyl]phenyl]phenyl]methyl]-2-(6-methoxy-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 123780890 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[[2-[2-[2-(4-hydroxyphenyl)ethenyl]phenyl]phenyl]methyl]-2-(6-methoxy-3-pyridinyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCc2ccccc2-c2ccccc2C=Cc2ccc(O)cc2)cn1 |
| InChI | InChI=1S/C29H26N2O3/c1-34-29-17-13-22(19-31-29)18-28(33)30-20-24-7-3-5-9-27(24)26-8-4-2-6-23(26)14-10-21-11-15-25(32)16-12-21/h2-17,19,32H,18,20H2,1H3,(H,30,33) |
| InChIKey | QHSZVWOTIUXZSZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|