C20H24Cl2FN7O — CID 123700252
4-[(2,6-dichloro-3-fluorophenyl)methyl]-5-[2-imino-2-(3-piperidin-4-yl-1,2,4-oxadiazol-5-yl)ethyl]-3,5-dihydro-2H-pyrazin-6-amine (PubChem CID 123700252) has the molecular formula C20H24Cl2FN7O and a molecular weight of 468.36 g/mol. Its IUPAC name is 4-[(2,6-dichloro-3-fluorophenyl)methyl]-5-[2-imino-2-(3-piperidin-4-yl-1,2,4-oxadiazol-5-yl)ethyl]-3,5-dihydro-2H-pyrazin-6-amine.
| Compound Name | 4-[(2,6-dichloro-3-fluorophenyl)methyl]-5-[2-imino-2-(3-piperidin-4-yl-1,2,4-oxadiazol-5-yl)ethyl]-3,5-dihydro-2H-pyrazin-6-amine |
|---|---|
| PubChem CID | 123700252 |
| Molecular Formula | C20H24Cl2FN7O |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 4-[(2,6-dichloro-3-fluorophenyl)methyl]-5-[2-imino-2-(3-piperidin-4-yl-1,2,4-oxadiazol-5-yl)ethyl]-3,5-dihydro-2H-pyrazin-6-amine |
| SMILES | [H]/N=C(/CC1C(N)=NCCN1Cc1c(Cl)ccc(F)c1Cl)c1nc(C2CCNCC2)no1 |
| InChI | InChI=1S/C20H24Cl2FN7O/c21-13-1-2-14(23)17(22)12(13)10-30-8-7-27-18(25)16(30)9-15(24)20-28-19(29-31-20)11-3-5-26-6-4-11/h1-2,11,16,24,26H,3-10H2,(H2,25,27)/b24-15- |
| InChIKey | QAKRWOVKZUCJMC-IWIPYMOSSA-N |
| XLogP | 2.98 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|