C13H15Cl3N4 — CID 123775802
2-[6-amino-4-[(2,6-dichlorophenyl)methyl]-3,5-dihydro-2H-pyrazin-5-yl]ethanimidoyl chloride (PubChem CID 123775802) has the molecular formula C13H15Cl3N4 and a molecular weight of 333.65 g/mol. Its IUPAC name is 2-[6-amino-4-[(2,6-dichlorophenyl)methyl]-3,5-dihydro-2H-pyrazin-5-yl]ethanimidoyl chloride.
| Compound Name | 2-[6-amino-4-[(2,6-dichlorophenyl)methyl]-3,5-dihydro-2H-pyrazin-5-yl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 123775802 |
| Molecular Formula | C13H15Cl3N4 |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-[6-amino-4-[(2,6-dichlorophenyl)methyl]-3,5-dihydro-2H-pyrazin-5-yl]ethanimidoyl chloride |
| SMILES | [H]/N=C(\Cl)CC1C(N)=NCCN1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H15Cl3N4/c14-9-2-1-3-10(15)8(9)7-20-5-4-19-13(18)11(20)6-12(16)17/h1-3,11,17H,4-7H2,(H2,18,19)/b17-12- |
| InChIKey | GOSJKONUAIPKHE-ATVHPVEESA-N |
| XLogP | 3.14 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|