C24H22ClN5O3 — CID 123700640
4-chloro-N-methoxy-3-[2-[[2-(prop-2-ynoylamino)cyclopentyl]amino]quinazolin-6-yl]benzamide (PubChem CID 123700640) has the molecular formula C24H22ClN5O3 and a molecular weight of 463.93 g/mol. Its IUPAC name is 4-chloro-N-methoxy-3-[2-[[2-(prop-2-ynoylamino)cyclopentyl]amino]quinazolin-6-yl]benzamide.
| Compound Name | 4-chloro-N-methoxy-3-[2-[[2-(prop-2-ynoylamino)cyclopentyl]amino]quinazolin-6-yl]benzamide |
|---|---|
| PubChem CID | 123700640 |
| Molecular Formula | C24H22ClN5O3 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 4-chloro-N-methoxy-3-[2-[[2-(prop-2-ynoylamino)cyclopentyl]amino]quinazolin-6-yl]benzamide |
| SMILES | C#CC(=O)NC1CCCC1Nc1ncc2cc(-c3cc(C(=O)NOC)ccc3Cl)ccc2n1 |
| InChI | InChI=1S/C24H22ClN5O3/c1-3-22(31)27-20-5-4-6-21(20)29-24-26-13-16-11-14(8-10-19(16)28-24)17-12-15(7-9-18(17)25)23(32)30-33-2/h1,7-13,20-21H,4-6H2,2H3,(H,27,31)(H,30,32)(H,26,28,29) |
| InChIKey | CGQBQGXABPEZOI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|