C23H20F2N4O2 — CID 118036427
N-[(1R)-2-[[6-(2,6-difluoro-3-methoxyphenyl)quinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide (PubChem CID 118036427) has the molecular formula C23H20F2N4O2 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[(1R)-2-[[6-(2,6-difluoro-3-methoxyphenyl)quinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide.
| Compound Name | N-[(1R)-2-[[6-(2,6-difluoro-3-methoxyphenyl)quinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide |
|---|---|
| PubChem CID | 118036427 |
| Molecular Formula | C23H20F2N4O2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[(1R)-2-[[6-(2,6-difluoro-3-methoxyphenyl)quinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide |
| SMILES | C#CC(=O)N[C@@H]1CCCC1Nc1ncc2cc(-c3c(F)ccc(OC)c3F)ccc2n1 |
| InChI | InChI=1S/C23H20F2N4O2/c1-3-20(30)27-17-5-4-6-18(17)29-23-26-12-14-11-13(7-9-16(14)28-23)21-15(24)8-10-19(31-2)22(21)25/h1,7-12,17-18H,4-6H2,2H3,(H,27,30)(H,26,28,29)/t17-,18?/m1/s1 |
| InChIKey | USBIAIATFYCLGM-QNSVNVJESA-N |
| XLogP | 3.67 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|