C15H26ClNO2Si — CID 123701807
2-(2-chloro-6-methoxyphenyl)-2-triethylsilyloxyethanamine (PubChem CID 123701807) has the molecular formula C15H26ClNO2Si and a molecular weight of 315.92 g/mol. Its IUPAC name is 2-(2-chloro-6-methoxyphenyl)-2-triethylsilyloxyethanamine.
| Compound Name | 2-(2-chloro-6-methoxyphenyl)-2-triethylsilyloxyethanamine |
|---|---|
| PubChem CID | 123701807 |
| Molecular Formula | C15H26ClNO2Si |
| Molecular Weight | 315.92 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-(2-chloro-6-methoxyphenyl)-2-triethylsilyloxyethanamine |
| SMILES | CC[Si](CC)(CC)OC(CN)c1c(Cl)cccc1OC |
| InChI | InChI=1S/C15H26ClNO2Si/c1-5-20(6-2,7-3)19-14(11-17)15-12(16)9-8-10-13(15)18-4/h8-10,14H,5-7,11,17H2,1-4H3 |
| InChIKey | MBPDHLOXVHCKTK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|