C22H21ClN2O2 — CID 123701847
(2S)-2-amino-N-[(2S)-1-(4-chlorophenyl)-3-oxopropan-2-yl]-N-naphthalen-2-ylpropanamide (PubChem CID 123701847) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1-(4-chlorophenyl)-3-oxopropan-2-yl]-N-naphthalen-2-ylpropanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-1-(4-chlorophenyl)-3-oxopropan-2-yl]-N-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 123701847 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1-(4-chlorophenyl)-3-oxopropan-2-yl]-N-naphthalen-2-ylpropanamide |
| SMILES | C[C@H](N)C(=O)N(c1ccc2ccccc2c1)[C@H](C=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O2/c1-15(24)22(27)25(20-11-8-17-4-2-3-5-18(17)13-20)21(14-26)12-16-6-9-19(23)10-7-16/h2-11,13-15,21H,12,24H2,1H3/t15-,21-/m0/s1 |
| InChIKey | LMKQSMUIGIKHMK-BTYIYWSLSA-N |
| XLogP | 3.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|