C22H40N2O5S — CID 123702585
propan-2-yl 4-[2-[2-[(1-ethylsulfonylpiperidin-4-yl)methoxy]ethyl]cyclopropyl]piperidine-1-carboxylate (PubChem CID 123702585) has the molecular formula C22H40N2O5S and a molecular weight of 444.64 g/mol. Its IUPAC name is propan-2-yl 4-[2-[2-[(1-ethylsulfonylpiperidin-4-yl)methoxy]ethyl]cyclopropyl]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[2-[2-[(1-ethylsulfonylpiperidin-4-yl)methoxy]ethyl]cyclopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123702585 |
| Molecular Formula | C22H40N2O5S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | propan-2-yl 4-[2-[2-[(1-ethylsulfonylpiperidin-4-yl)methoxy]ethyl]cyclopropyl]piperidine-1-carboxylate |
| SMILES | CCS(=O)(=O)N1CCC(COCCC2CC2C2CCN(C(=O)OC(C)C)CC2)CC1 |
| InChI | InChI=1S/C22H40N2O5S/c1-4-30(26,27)24-12-5-18(6-13-24)16-28-14-9-20-15-21(20)19-7-10-23(11-8-19)22(25)29-17(2)3/h17-21H,4-16H2,1-3H3 |
| InChIKey | GYHBTAOUVSEQDG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|