C16H30N2O3S — CID 126693796
4-[(1R)-2-[2-[(3S)-1-ethylsulfonylpyrrolidin-3-yl]oxyethyl]cyclopropyl]piperidine (PubChem CID 126693796) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is 4-[(1R)-2-[2-[(3S)-1-ethylsulfonylpyrrolidin-3-yl]oxyethyl]cyclopropyl]piperidine.
| Compound Name | 4-[(1R)-2-[2-[(3S)-1-ethylsulfonylpyrrolidin-3-yl]oxyethyl]cyclopropyl]piperidine |
|---|---|
| PubChem CID | 126693796 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 4-[(1R)-2-[2-[(3S)-1-ethylsulfonylpyrrolidin-3-yl]oxyethyl]cyclopropyl]piperidine |
| SMILES | CCS(=O)(=O)N1CC[C@H](OCCC2C[C@@H]2C2CCNCC2)C1 |
| InChI | InChI=1S/C16H30N2O3S/c1-2-22(19,20)18-9-5-15(12-18)21-10-6-14-11-16(14)13-3-7-17-8-4-13/h13-17H,2-12H2,1H3/t14?,15-,16+/m0/s1 |
| InChIKey | OHJGLNAYOKRDPL-MERJSTESSA-N |
| XLogP | 1.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |