C8H10N2O — CID 123706467
5-ethoxy-2,3-dimethylidenepyrazine (PubChem CID 123706467) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 5-ethoxy-2,3-dimethylidenepyrazine.
| Compound Name | 5-ethoxy-2,3-dimethylidenepyrazine |
|---|---|
| PubChem CID | 123706467 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 5-ethoxy-2,3-dimethylidenepyrazine |
| SMILES | C=c1ncc(OCC)nc1=C |
| InChI | InChI=1S/C8H10N2O/c1-4-11-8-5-9-6(2)7(3)10-8/h5H,2-4H2,1H3 |
| InChIKey | IFUQPAVJBUYXDO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |