About 2-ethoxy-5-iodopyrazine
2-ethoxy-5-iodopyrazine (PubChem CID 87678198) has the molecular formula C6H7IN2O
and a molecular weight of 250.04 g/mol. Its IUPAC name is 2-ethoxy-5-iodopyrazine.
Molecular Properties
| Compound Name | 2-ethoxy-5-iodopyrazine |
| PubChem CID | 87678198 |
| Molecular Formula | C6H7IN2O |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | 2-ethoxy-5-iodopyrazine |
| SMILES | CCOc1cnc(I)cn1 |
| InChI | InChI=1S/C6H7IN2O/c1-2-10-6-4-8-5(7)3-9-6/h3-4H,2H2,1H3 |
| InChIKey | GICZMDZOYQCSQA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-5-iodopyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-5-iodopyrazine?
The IUPAC name of 2-ethoxy-5-iodopyrazine (CID 87678198) is 2-ethoxy-5-iodopyrazine.
What is the SMILES notation for 2-ethoxy-5-iodopyrazine?
The canonical SMILES for 2-ethoxy-5-iodopyrazine is CCOc1cnc(I)cn1.
What is the InChIKey of 2-ethoxy-5-iodopyrazine?
The InChIKey is GICZMDZOYQCSQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2O/c1-2-10-6-4-8-5(7)3-9-6/h3-4H,2H2,1H3.
What are the key properties of 2-ethoxy-5-iodopyrazine?
2-ethoxy-5-iodopyrazine has a molecular weight of 250.04 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5-iodopyrazine is sourced from PubChem (CID 87678198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).