C35H30N8O12S4 — CID 123707121
3-[[4-[[4-[(4-phenyldiazenylphenyl)methyl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid;sulfur trioxide (PubChem CID 123707121) has the molecular formula C35H30N8O12S4 and a molecular weight of 882.94 g/mol. Its IUPAC name is 3-[[4-[[4-[(4-phenyldiazenylphenyl)methyl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid;sulfur trioxide.
| Compound Name | 3-[[4-[[4-[(4-phenyldiazenylphenyl)methyl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 123707121 |
| Molecular Formula | C35H30N8O12S4 |
| Molecular Weight | 882.94 g/mol |
| Exact Mass | 882.09 |
| IUPAC Name | 3-[[4-[[4-[(4-phenyldiazenylphenyl)methyl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid;sulfur trioxide |
| SMILES | O=S(=O)(O)CCNc1nc(Cc2ccc(/N=N/c3ccccc3)cc2)nc(Cc2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)cc2)n1.O=S(=O)=O |
| InChI | InChI=1S/C35H30N8O9S3.O3S/c44-53(45,46)18-17-36-35-38-33(19-23-9-13-26(14-10-23)41-40-25-5-2-1-3-6-25)37-34(39-35)20-24-11-15-27(16-12-24)42-43-28-21-30-29(32(22-28)55(50,51)52)7-4-8-31(30)54(47,48)49;1-4(2)3/h1-16,21-22H,17-20H2,(H,44,45,46)(H,47,48,49)(H,50,51,52)(H,36,37,38,39);/b41-40+,43-42+; |
| InChIKey | ROGHJFAIPXDSIX-DRSDEFSQSA-N |
| XLogP | 5.83 |
| TPSA | 314.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.94 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|