C37H27N7O13S4 — CID 158487849
3-[[4-[[4-[[4-[(4,8-disulfonaphthalen-2-yl)diazenyl]phenyl]methyl]-6-oxo-1H-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 158487849) has the molecular formula C37H27N7O13S4 and a molecular weight of 905.93 g/mol. Its IUPAC name is 3-[[4-[[4-[[4-[(4,8-disulfonaphthalen-2-yl)diazenyl]phenyl]methyl]-6-oxo-1H-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[[4-[[4-[(4,8-disulfonaphthalen-2-yl)diazenyl]phenyl]methyl]-6-oxo-1H-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 158487849 |
| Molecular Formula | C37H27N7O13S4 |
| Molecular Weight | 905.93 g/mol |
| Exact Mass | 905.05 |
| IUPAC Name | 3-[[4-[[4-[[4-[(4,8-disulfonaphthalen-2-yl)diazenyl]phenyl]methyl]-6-oxo-1H-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | O=c1nc(Cc2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)cc2)nc(Cc2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)cc2)[nH]1 |
| InChI | InChI=1S/C37H27N7O13S4/c45-37-39-35(15-21-7-11-23(12-8-21)41-43-25-17-29-27(33(19-25)60(52,53)54)3-1-5-31(29)58(46,47)48)38-36(40-37)16-22-9-13-24(14-10-22)42-44-26-18-30-28(34(20-26)61(55,56)57)4-2-6-32(30)59(49,50)51/h1-14,17-20H,15-16H2,(H,46,47,48)(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,38,39,40,45)/b43-41+,44-42+ |
| InChIKey | SKDUQOJUNHZYMF-CHQNLTHESA-N |
| XLogP | 6.47 |
| TPSA | 325.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.93 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|