C36H32N8O12S4 — CID 58165342
3-[[3-methyl-4-[[4-[(4-phenyldiazenyl-2-sulfophenyl)methyl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 58165342) has the molecular formula C36H32N8O12S4 and a molecular weight of 896.96 g/mol. Its IUPAC name is 3-[[3-methyl-4-[[4-[(4-phenyldiazenyl-2-sulfophenyl)methyl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[3-methyl-4-[[4-[(4-phenyldiazenyl-2-sulfophenyl)methyl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 58165342 |
| Molecular Formula | C36H32N8O12S4 |
| Molecular Weight | 896.96 g/mol |
| Exact Mass | 896.10 |
| IUPAC Name | 3-[[3-methyl-4-[[4-[(4-phenyldiazenyl-2-sulfophenyl)methyl]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | Cc1cc(/N=N/c2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)ccc1Cc1nc(Cc2ccc(/N=N/c3ccccc3)cc2S(=O)(=O)O)nc(NCCS(=O)(=O)O)n1 |
| InChI | InChI=1S/C36H32N8O12S4/c1-22-16-26(42-44-28-19-30-29(33(21-28)60(54,55)56)8-5-9-31(30)58(48,49)50)12-10-23(22)17-34-38-35(40-36(39-34)37-14-15-57(45,46)47)18-24-11-13-27(20-32(24)59(51,52)53)43-41-25-6-3-2-4-7-25/h2-13,16,19-21H,14-15,17-18H2,1H3,(H,45,46,47)(H,48,49,50)(H,51,52,53)(H,54,55,56)(H,37,38,39,40)/b43-41+,44-42+ |
| InChIKey | XXYUZROZBPRBAK-CHQNLTHESA-N |
| XLogP | 6.39 |
| TPSA | 317.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.96 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|