C26H34N6O10S3 — CID 158663344
[3-[[4-[[4-ethyl-6-(2-methoxysulfonylethylamino)-1,3,5-triazin-2-yl]methyl]-3-(3-methoxysulfonylpropoxy)phenyl]diazenyl]phenyl]methanesulfonic acid (PubChem CID 158663344) has the molecular formula C26H34N6O10S3 and a molecular weight of 686.79 g/mol. Its IUPAC name is [3-[[4-[[4-ethyl-6-(2-methoxysulfonylethylamino)-1,3,5-triazin-2-yl]methyl]-3-(3-methoxysulfonylpropoxy)phenyl]diazenyl]phenyl]methanesulfonic acid.
| Compound Name | [3-[[4-[[4-ethyl-6-(2-methoxysulfonylethylamino)-1,3,5-triazin-2-yl]methyl]-3-(3-methoxysulfonylpropoxy)phenyl]diazenyl]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 158663344 |
| Molecular Formula | C26H34N6O10S3 |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 686.15 |
| IUPAC Name | [3-[[4-[[4-ethyl-6-(2-methoxysulfonylethylamino)-1,3,5-triazin-2-yl]methyl]-3-(3-methoxysulfonylpropoxy)phenyl]diazenyl]phenyl]methanesulfonic acid |
| SMILES | CCc1nc(Cc2ccc(/N=N/c3cccc(CS(=O)(=O)O)c3)cc2OCCCS(=O)(=O)OC)nc(NCCS(=O)(=O)OC)n1 |
| InChI | InChI=1S/C26H34N6O10S3/c1-4-24-28-25(30-26(29-24)27-11-14-45(38,39)41-3)16-20-9-10-22(17-23(20)42-12-6-13-44(36,37)40-2)32-31-21-8-5-7-19(15-21)18-43(33,34)35/h5,7-10,15,17H,4,6,11-14,16,18H2,1-3H3,(H,33,34,35)(H,27,28,29,30)/b32-31+ |
| InChIKey | LGLLZSPBBZFJHM-QNEJGDQOSA-N |
| XLogP | 2.96 |
| TPSA | 225.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|