C27H29N5O13S6 — CID 147145673
3-[[4-[[4,6-bis(3-sulfopropylsulfanyl)-1,3,5-triazin-2-yl]methyl]-3-methoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 147145673) has the molecular formula C27H29N5O13S6 and a molecular weight of 823.95 g/mol. Its IUPAC name is 3-[[4-[[4,6-bis(3-sulfopropylsulfanyl)-1,3,5-triazin-2-yl]methyl]-3-methoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[[4,6-bis(3-sulfopropylsulfanyl)-1,3,5-triazin-2-yl]methyl]-3-methoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 147145673 |
| Molecular Formula | C27H29N5O13S6 |
| Molecular Weight | 823.95 g/mol |
| Exact Mass | 823.01 |
| IUPAC Name | 3-[[4-[[4,6-bis(3-sulfopropylsulfanyl)-1,3,5-triazin-2-yl]methyl]-3-methoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | COc1cc(/N=N/c2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)ccc1Cc1nc(SCCCS(=O)(=O)O)nc(SCCCS(=O)(=O)O)n1 |
| InChI | InChI=1S/C27H29N5O13S6/c1-45-22-15-18(31-32-19-14-21-20(24(16-19)51(42,43)44)5-2-6-23(21)50(39,40)41)8-7-17(22)13-25-28-26(46-9-3-11-48(33,34)35)30-27(29-25)47-10-4-12-49(36,37)38/h2,5-8,14-16H,3-4,9-13H2,1H3,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,42,43,44)/b32-31+ |
| InChIKey | BSZQVHSVEIRTFE-QNEJGDQOSA-N |
| XLogP | 4.27 |
| TPSA | 290.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|