C26H28N6O13S5 — CID 90471055
4-[[4,6-bis(3-sulfopropyl)-1,3,5-triazin-2-yl]-sulfanylamino]-7-[(3-methoxyphenyl)diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 90471055) has the molecular formula C26H28N6O13S5 and a molecular weight of 792.87 g/mol. Its IUPAC name is 4-[[4,6-bis(3-sulfopropyl)-1,3,5-triazin-2-yl]-sulfanylamino]-7-[(3-methoxyphenyl)diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 4-[[4,6-bis(3-sulfopropyl)-1,3,5-triazin-2-yl]-sulfanylamino]-7-[(3-methoxyphenyl)diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 90471055 |
| Molecular Formula | C26H28N6O13S5 |
| Molecular Weight | 792.87 g/mol |
| Exact Mass | 792.03 |
| IUPAC Name | 4-[[4,6-bis(3-sulfopropyl)-1,3,5-triazin-2-yl]-sulfanylamino]-7-[(3-methoxyphenyl)diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | COc1cccc(/N=N/c2ccc3c(N(S)c4nc(CCCS(=O)(=O)O)nc(CCCS(=O)(=O)O)n4)c(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2)c1 |
| InChI | InChI=1S/C26H28N6O13S5/c1-45-18-6-2-5-16(13-18)30-31-17-9-10-19-20(14-17)21(49(39,40)41)15-22(50(42,43)44)25(19)32(46)26-28-23(7-3-11-47(33,34)35)27-24(29-26)8-4-12-48(36,37)38/h2,5-6,9-10,13-15,46H,3-4,7-8,11-12H2,1H3,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,42,43,44)/b31-30+ |
| InChIKey | IGZDILWVJBQPRR-NVQSTNCTSA-N |
| XLogP | 3.57 |
| TPSA | 293.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.87 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|