C6H13N3 — CID 123707710
5-propyl-4,5-dihydro-1H-pyrazol-3-amine (PubChem CID 123707710) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is 5-propyl-4,5-dihydro-1H-pyrazol-3-amine.
| Compound Name | 5-propyl-4,5-dihydro-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 123707710 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 5-propyl-4,5-dihydro-1H-pyrazol-3-amine |
| SMILES | CCCC1CC(N)=NN1 |
| InChI | InChI=1S/C6H13N3/c1-2-3-5-4-6(7)9-8-5/h5,8H,2-4H2,1H3,(H2,7,9) |
| InChIKey | WQEDBZCHMYXWEZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |