C5H11N3 — CID 154018859
5-ethyl-4,5-dihydro-1H-pyrazol-3-amine (PubChem CID 154018859) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 5-ethyl-4,5-dihydro-1H-pyrazol-3-amine.
| Compound Name | 5-ethyl-4,5-dihydro-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 154018859 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 5-ethyl-4,5-dihydro-1H-pyrazol-3-amine |
| SMILES | CCC1CC(N)=NN1 |
| InChI | InChI=1S/C5H11N3/c1-2-4-3-5(6)8-7-4/h4,7H,2-3H2,1H3,(H2,6,8) |
| InChIKey | RLYVZGXVSMGCAT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |