C14H16FNO2 — CID 123707721
methyl 3-fluoro-2,5-dimethylidene-6-(2-methylprop-2-enylideneamino)hepta-3,6-dienoate (PubChem CID 123707721) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is methyl 3-fluoro-2,5-dimethylidene-6-(2-methylprop-2-enylideneamino)hepta-3,6-dienoate.
| Compound Name | methyl 3-fluoro-2,5-dimethylidene-6-(2-methylprop-2-enylideneamino)hepta-3,6-dienoate |
|---|---|
| PubChem CID | 123707721 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | methyl 3-fluoro-2,5-dimethylidene-6-(2-methylprop-2-enylideneamino)hepta-3,6-dienoate |
| SMILES | C=C(C)/C=N/C(=C)C(=C)C=C(F)C(=C)C(=O)OC |
| InChI | InChI=1S/C14H16FNO2/c1-9(2)8-16-12(5)10(3)7-13(15)11(4)14(17)18-6/h7-8H,1,3-5H2,2,6H3/b13-7?,16-8+ |
| InChIKey | BOGBTMTZPDBYJU-GVTZZKNWSA-N |
| XLogP | 3.29 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|