C11H13NO2 — CID 123728530
methyl 5,6-di(ethylidene)pyridine-3-carboxylate (PubChem CID 123728530) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is methyl 5,6-di(ethylidene)pyridine-3-carboxylate.
| Compound Name | methyl 5,6-di(ethylidene)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 123728530 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | methyl 5,6-di(ethylidene)pyridine-3-carboxylate |
| SMILES | CC=c1cc(C(=O)OC)cnc1=CC |
| InChI | InChI=1S/C11H13NO2/c1-4-8-6-9(11(13)14-3)7-12-10(8)5-2/h4-7H,1-3H3 |
| InChIKey | QSAJTNVVVCNVEL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |