C20H28N2O2 — CID 123211409
methyl (3E,5Z)-7-(but-2-enylideneamino)-2-butylidene-4-methyl-5-(methyliminomethyl)octa-3,5,7-trienoate (PubChem CID 123211409) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is methyl (3E,5Z)-7-(but-2-enylideneamino)-2-butylidene-4-methyl-5-(methyliminomethyl)octa-3,5,7-trienoate.
| Compound Name | methyl (3E,5Z)-7-(but-2-enylideneamino)-2-butylidene-4-methyl-5-(methyliminomethyl)octa-3,5,7-trienoate |
|---|---|
| PubChem CID | 123211409 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | methyl (3E,5Z)-7-(but-2-enylideneamino)-2-butylidene-4-methyl-5-(methyliminomethyl)octa-3,5,7-trienoate |
| SMILES | C=C(/C=C(\C=N\C)C(/C)=C/C(=CCCC)C(=O)OC)/N=C/C=CC |
| InChI | InChI=1S/C20H28N2O2/c1-7-9-11-18(20(23)24-6)13-16(3)19(15-21-5)14-17(4)22-12-10-8-2/h8,10-15H,4,7,9H2,1-3,5-6H3/b10-8?,16-13+,18-11?,19-14+,21-15+,22-12+ |
| InChIKey | JBVMVXMBFCHIOQ-DBILNNNYSA-N |
| XLogP | 4.62 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|