C16H19N5S2 — CID 123707857
2-amino-N-[1-amino-4-imino-3-(thiophen-2-ylmethylsulfanyl)butylidene]benzenecarboximidamide (PubChem CID 123707857) has the molecular formula C16H19N5S2 and a molecular weight of 345.50 g/mol. Its IUPAC name is 2-amino-N-[1-amino-4-imino-3-(thiophen-2-ylmethylsulfanyl)butylidene]benzenecarboximidamide.
| Compound Name | 2-amino-N-[1-amino-4-imino-3-(thiophen-2-ylmethylsulfanyl)butylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 123707857 |
| Molecular Formula | C16H19N5S2 |
| Molecular Weight | 345.50 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-amino-N-[1-amino-4-imino-3-(thiophen-2-ylmethylsulfanyl)butylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N)CC(/C=N/[H])SCc1cccs1)c1ccccc1N |
| InChI | InChI=1S/C16H19N5S2/c17-9-12(23-10-11-4-3-7-22-11)8-15(19)21-16(20)13-5-1-2-6-14(13)18/h1-7,9,12,17H,8,10,18H2,(H3,19,20,21)/b17-9+ |
| InChIKey | KTICWKMMBXMYOF-RQZCQDPDSA-N |
| XLogP | 3.35 |
| TPSA | 112.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|