C30H48O2 — CID 123712609
ethyl 2-(3,7-dimethylocta-2,6-dienyl)-6,10-dimethyl-3-pent-1-enylundeca-2,5,9-trienoate (PubChem CID 123712609) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is ethyl 2-(3,7-dimethylocta-2,6-dienyl)-6,10-dimethyl-3-pent-1-enylundeca-2,5,9-trienoate.
| Compound Name | ethyl 2-(3,7-dimethylocta-2,6-dienyl)-6,10-dimethyl-3-pent-1-enylundeca-2,5,9-trienoate |
|---|---|
| PubChem CID | 123712609 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | ethyl 2-(3,7-dimethylocta-2,6-dienyl)-6,10-dimethyl-3-pent-1-enylundeca-2,5,9-trienoate |
| SMILES | CCCC=CC(CC=C(C)CCC=C(C)C)=C(CC=C(C)CCC=C(C)C)C(=O)OCC |
| InChI | InChI=1S/C30H48O2/c1-9-11-12-19-28(22-20-26(7)17-13-15-24(3)4)29(30(31)32-10-2)23-21-27(8)18-14-16-25(5)6/h12,15-16,19-21H,9-11,13-14,17-18,22-23H2,1-8H3 |
| InChIKey | JBGHKEAAJOODAQ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|