C12H20N2S — CID 123713461
1-(4-methylcyclohexa-1,5-dien-1-yl)-4-sulfanyl-1,4-diazepane (PubChem CID 123713461) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(4-methylcyclohexa-1,5-dien-1-yl)-4-sulfanyl-1,4-diazepane.
| Compound Name | 1-(4-methylcyclohexa-1,5-dien-1-yl)-4-sulfanyl-1,4-diazepane |
|---|---|
| PubChem CID | 123713461 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-(4-methylcyclohexa-1,5-dien-1-yl)-4-sulfanyl-1,4-diazepane |
| SMILES | CC1C=CC(N2CCCN(S)CC2)=CC1 |
| InChI | InChI=1S/C12H20N2S/c1-11-3-5-12(6-4-11)13-7-2-8-14(15)10-9-13/h3,5-6,11,15H,2,4,7-10H2,1H3 |
| InChIKey | KRXCDWUZZLZIFV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|