C15H26N2 — CID 145305867
1-butan-2-yl-4-cyclohexa-1,3-dien-1-yl-1,4-diazepane (PubChem CID 145305867) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-butan-2-yl-4-cyclohexa-1,3-dien-1-yl-1,4-diazepane.
| Compound Name | 1-butan-2-yl-4-cyclohexa-1,3-dien-1-yl-1,4-diazepane |
|---|---|
| PubChem CID | 145305867 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-butan-2-yl-4-cyclohexa-1,3-dien-1-yl-1,4-diazepane |
| SMILES | CCC(C)N1CCCN(C2=CC=CCC2)CC1 |
| InChI | InChI=1S/C15H26N2/c1-3-14(2)16-10-7-11-17(13-12-16)15-8-5-4-6-9-15/h4-5,8,14H,3,6-7,9-13H2,1-2H3 |
| InChIKey | AFTNFIIEXFILGZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |