C12H22O2 — CID 123715337
2-(hydroxymethyl)-3,7-dimethylbicyclo[3.3.1]nonan-2-ol (PubChem CID 123715337) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,7-dimethylbicyclo[3.3.1]nonan-2-ol.
| Compound Name | 2-(hydroxymethyl)-3,7-dimethylbicyclo[3.3.1]nonan-2-ol |
|---|---|
| PubChem CID | 123715337 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-(hydroxymethyl)-3,7-dimethylbicyclo[3.3.1]nonan-2-ol |
| SMILES | CC1CC2CC(C)C(O)(CO)C(C1)C2 |
| InChI | InChI=1S/C12H22O2/c1-8-3-10-5-9(2)12(14,7-13)11(4-8)6-10/h8-11,13-14H,3-7H2,1-2H3 |
| InChIKey | KSRAYNLHKXPZGJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |