C24H24F3N5O3 — CID 123718641
3-hydroxy-2'-(5-methoxy-3-pyridinyl)-4,4'-dimethyl-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[cyclopentane-1,7'-pyrrolo[3,4-b]pyridine]-5'-one (PubChem CID 123718641) has the molecular formula C24H24F3N5O3 and a molecular weight of 487.48 g/mol. Its IUPAC name is 3-hydroxy-2'-(5-methoxy-3-pyridinyl)-4,4'-dimethyl-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[cyclopentane-1,7'-pyrrolo[3,4-b]pyridine]-5'-one.
| Compound Name | 3-hydroxy-2'-(5-methoxy-3-pyridinyl)-4,4'-dimethyl-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[cyclopentane-1,7'-pyrrolo[3,4-b]pyridine]-5'-one |
|---|---|
| PubChem CID | 123718641 |
| Molecular Formula | C24H24F3N5O3 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 3-hydroxy-2'-(5-methoxy-3-pyridinyl)-4,4'-dimethyl-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[cyclopentane-1,7'-pyrrolo[3,4-b]pyridine]-5'-one |
| SMILES | COc1cncc(-c2cc(C)c3c(n2)C2(CC(C)C(O)C2)N(c2cnn(CC(F)(F)F)c2)C3=O)c1 |
| InChI | InChI=1S/C24H24F3N5O3/c1-13-4-18(15-5-17(35-3)10-28-8-15)30-21-20(13)22(34)32(23(21)6-14(2)19(33)7-23)16-9-29-31(11-16)12-24(25,26)27/h4-5,8-11,14,19,33H,6-7,12H2,1-3H3 |
| InChIKey | CFSKWZNAJWNIAT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |