C20H15F6N5O2 — CID 88573833
4-methyl-2-[5-(2,2,2-trifluoroethoxy)-3-pyridinyl]-6-[1-(2,2,2-trifluoroethyl)imidazol-4-yl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 88573833) has the molecular formula C20H15F6N5O2 and a molecular weight of 471.36 g/mol. Its IUPAC name is 4-methyl-2-[5-(2,2,2-trifluoroethoxy)-3-pyridinyl]-6-[1-(2,2,2-trifluoroethyl)imidazol-4-yl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 4-methyl-2-[5-(2,2,2-trifluoroethoxy)-3-pyridinyl]-6-[1-(2,2,2-trifluoroethyl)imidazol-4-yl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 88573833 |
| Molecular Formula | C20H15F6N5O2 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-methyl-2-[5-(2,2,2-trifluoroethoxy)-3-pyridinyl]-6-[1-(2,2,2-trifluoroethyl)imidazol-4-yl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | Cc1cc(-c2cncc(OCC(F)(F)F)c2)nc2c1C(=O)N(c1cn(CC(F)(F)F)cn1)C2 |
| InChI | InChI=1S/C20H15F6N5O2/c1-11-2-14(12-3-13(5-27-4-12)33-9-20(24,25)26)29-15-6-31(18(32)17(11)15)16-7-30(10-28-16)8-19(21,22)23/h2-5,7,10H,6,8-9H2,1H3 |
| InChIKey | VEURDDZDFLKPAE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |