C23H25F3N6O3S — CID 158464866
N,N-dimethyl-1-[5-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]-3-pyridinyl]methanesulfonamide (PubChem CID 158464866) has the molecular formula C23H25F3N6O3S and a molecular weight of 522.55 g/mol. Its IUPAC name is N,N-dimethyl-1-[5-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N,N-dimethyl-1-[5-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 158464866 |
| Molecular Formula | C23H25F3N6O3S |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N,N-dimethyl-1-[5-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]-3-pyridinyl]methanesulfonamide |
| SMILES | Cc1cc(-c2cncc(CS(=O)(=O)N(C)C)c2)nc2c1C(=O)N(c1cnn(CC(F)(F)F)c1)C2(C)C |
| InChI | InChI=1S/C23H25F3N6O3S/c1-14-6-18(16-7-15(8-27-9-16)12-36(34,35)30(4)5)29-20-19(14)21(33)32(22(20,2)3)17-10-28-31(11-17)13-23(24,25)26/h6-11H,12-13H2,1-5H3 |
| InChIKey | MALDJZAJGMZZGY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |