C24H27F3N6O3 — CID 171924539
(Z)-3-methoxy-N,2-dimethyl-3-[2-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]prop-2-enylideneamino]prop-2-enamide (PubChem CID 171924539) has the molecular formula C24H27F3N6O3 and a molecular weight of 504.51 g/mol. Its IUPAC name is (Z)-3-methoxy-N,2-dimethyl-3-[2-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]prop-2-enylideneamino]prop-2-enamide.
| Compound Name | (Z)-3-methoxy-N,2-dimethyl-3-[2-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]prop-2-enylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 171924539 |
| Molecular Formula | C24H27F3N6O3 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (Z)-3-methoxy-N,2-dimethyl-3-[2-[4,7,7-trimethyl-5-oxo-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,4-b]pyridin-2-yl]prop-2-enylideneamino]prop-2-enamide |
| SMILES | C=C(C=N/C(OC)=C(\C)C(=O)NC)c1cc(C)c2c(n1)C(C)(C)N(c1cnn(CC(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C24H27F3N6O3/c1-13-8-17(14(2)9-29-21(36-7)15(3)20(34)28-6)31-19-18(13)22(35)33(23(19,4)5)16-10-30-32(11-16)12-24(25,26)27/h8-11H,2,12H2,1,3-7H3,(H,28,34)/b21-15-,29-9? |
| InChIKey | LYLFZGNDSMPCLK-CYNOYWDBSA-N |
| XLogP | 3.75 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|