C24H25F3N4O3 — CID 131995265
(3S)-2'-[(3E,5E)-5-methoxyhepta-1,3,5-trien-3-yl]-4'-methyl-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[oxolane-3,7'-pyrrolo[3,4-b]pyridine]-5'-one (PubChem CID 131995265) has the molecular formula C24H25F3N4O3 and a molecular weight of 474.48 g/mol. Its IUPAC name is (3S)-2'-[(3E,5E)-5-methoxyhepta-1,3,5-trien-3-yl]-4'-methyl-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[oxolane-3,7'-pyrrolo[3,4-b]pyridine]-5'-one.
| Compound Name | (3S)-2'-[(3E,5E)-5-methoxyhepta-1,3,5-trien-3-yl]-4'-methyl-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[oxolane-3,7'-pyrrolo[3,4-b]pyridine]-5'-one |
|---|---|
| PubChem CID | 131995265 |
| Molecular Formula | C24H25F3N4O3 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (3S)-2'-[(3E,5E)-5-methoxyhepta-1,3,5-trien-3-yl]-4'-methyl-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[oxolane-3,7'-pyrrolo[3,4-b]pyridine]-5'-one |
| SMILES | C=C/C(=C\C(=C/C)OC)c1cc(C)c2c(n1)[C@]1(CCOC1)N(c1cnn(CC(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C24H25F3N4O3/c1-5-16(10-18(6-2)33-4)19-9-15(3)20-21(29-19)23(7-8-34-14-23)31(22(20)32)17-11-28-30(12-17)13-24(25,26)27/h5-6,9-12H,1,7-8,13-14H2,2-4H3/b16-10+,18-6+/t23-/m1/s1 |
| InChIKey | OMEAMAQQLCYPLK-PHBPJSNVSA-N |
| XLogP | 4.54 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|