C24H24ClFN4O — CID 123719346
1-[4-[6-chloro-7-(5-cyclopropyl-2-fluorophenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-ol (PubChem CID 123719346) has the molecular formula C24H24ClFN4O and a molecular weight of 438.93 g/mol. Its IUPAC name is 1-[4-[6-chloro-7-(5-cyclopropyl-2-fluorophenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-ol.
| Compound Name | 1-[4-[6-chloro-7-(5-cyclopropyl-2-fluorophenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123719346 |
| Molecular Formula | C24H24ClFN4O |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-[4-[6-chloro-7-(5-cyclopropyl-2-fluorophenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-ol |
| SMILES | C=CC(O)N1CCN(c2ncnc3cc(-c4cc(C5CC5)ccc4F)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C24H24ClFN4O/c1-2-23(31)29-7-9-30(10-8-29)24-19-12-20(25)17(13-22(19)27-14-28-24)18-11-16(15-3-4-15)5-6-21(18)26/h2,5-6,11-15,23,31H,1,3-4,7-10H2 |
| InChIKey | TUMIXFVFHWVMOA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|