C20H20FN5O3 — CID 156542816
7-(2-fluoro-6-hydroxyphenyl)-4-[4-(1-hydroxyprop-2-enyl)piperazin-1-yl]pyrido[3,4-d]pyrimidin-8-one (PubChem CID 156542816) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is 7-(2-fluoro-6-hydroxyphenyl)-4-[4-(1-hydroxyprop-2-enyl)piperazin-1-yl]pyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 7-(2-fluoro-6-hydroxyphenyl)-4-[4-(1-hydroxyprop-2-enyl)piperazin-1-yl]pyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 156542816 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 7-(2-fluoro-6-hydroxyphenyl)-4-[4-(1-hydroxyprop-2-enyl)piperazin-1-yl]pyrido[3,4-d]pyrimidin-8-one |
| SMILES | C=CC(O)N1CCN(c2ncnc3c(=O)n(-c4c(O)cccc4F)ccc23)CC1 |
| InChI | InChI=1S/C20H20FN5O3/c1-2-16(28)24-8-10-25(11-9-24)19-13-6-7-26(20(29)17(13)22-12-23-19)18-14(21)4-3-5-15(18)27/h2-7,12,16,27-28H,1,8-11H2 |
| InChIKey | YENKKMIBCSWBHB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|