C17H14FN5O3 — CID 135272457
1-(2-fluoro-6-hydroxyphenyl)-9-(1-prop-2-enoylazetidin-3-yl)purin-6-one (PubChem CID 135272457) has the molecular formula C17H14FN5O3 and a molecular weight of 355.33 g/mol. Its IUPAC name is 1-(2-fluoro-6-hydroxyphenyl)-9-(1-prop-2-enoylazetidin-3-yl)purin-6-one.
| Compound Name | 1-(2-fluoro-6-hydroxyphenyl)-9-(1-prop-2-enoylazetidin-3-yl)purin-6-one |
|---|---|
| PubChem CID | 135272457 |
| Molecular Formula | C17H14FN5O3 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-(2-fluoro-6-hydroxyphenyl)-9-(1-prop-2-enoylazetidin-3-yl)purin-6-one |
| SMILES | C=CC(=O)N1CC(n2cnc3c(=O)n(-c4c(O)cccc4F)cnc32)C1 |
| InChI | InChI=1S/C17H14FN5O3/c1-2-13(25)21-6-10(7-21)22-8-19-14-16(22)20-9-23(17(14)26)15-11(18)4-3-5-12(15)24/h2-5,8-10,24H,1,6-7H2 |
| InChIKey | IMXCFPLMBUIOCD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|