C14H16BrFN2O — CID 123724184
8-(5-bromo-2-fluorophenyl)-9-methyl-5-oxa-7-azaspiro[3.5]non-6-en-6-amine (PubChem CID 123724184) has the molecular formula C14H16BrFN2O and a molecular weight of 327.20 g/mol. Its IUPAC name is 8-(5-bromo-2-fluorophenyl)-9-methyl-5-oxa-7-azaspiro[3.5]non-6-en-6-amine.
| Compound Name | 8-(5-bromo-2-fluorophenyl)-9-methyl-5-oxa-7-azaspiro[3.5]non-6-en-6-amine |
|---|---|
| PubChem CID | 123724184 |
| Molecular Formula | C14H16BrFN2O |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 8-(5-bromo-2-fluorophenyl)-9-methyl-5-oxa-7-azaspiro[3.5]non-6-en-6-amine |
| SMILES | CC1C(c2cc(Br)ccc2F)N=C(N)OC12CCC2 |
| InChI | InChI=1S/C14H16BrFN2O/c1-8-12(10-7-9(15)3-4-11(10)16)18-13(17)19-14(8)5-2-6-14/h3-4,7-8,12H,2,5-6H2,1H3,(H2,17,18) |
| InChIKey | KXTBKPHFYYWUQE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |