C12H20O4S2 — CID 123724218
3,6-bis(2-ethylsulfanylethyl)-1,4-dioxane-2,5-dione (PubChem CID 123724218) has the molecular formula C12H20O4S2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3,6-bis(2-ethylsulfanylethyl)-1,4-dioxane-2,5-dione.
| Compound Name | 3,6-bis(2-ethylsulfanylethyl)-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 123724218 |
| Molecular Formula | C12H20O4S2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3,6-bis(2-ethylsulfanylethyl)-1,4-dioxane-2,5-dione |
| SMILES | CCSCCC1OC(=O)C(CCSCC)OC1=O |
| InChI | InChI=1S/C12H20O4S2/c1-3-17-7-5-9-11(13)16-10(12(14)15-9)6-8-18-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | NKANJVGMXQTYMO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|