C16H35NS — CID 123724327
N-butyl-1-ethylsulfanyl-3-methyl-N-propylhexan-1-amine (PubChem CID 123724327) has the molecular formula C16H35NS and a molecular weight of 273.53 g/mol. Its IUPAC name is N-butyl-1-ethylsulfanyl-3-methyl-N-propylhexan-1-amine.
| Compound Name | N-butyl-1-ethylsulfanyl-3-methyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 123724327 |
| Molecular Formula | C16H35NS |
| Molecular Weight | 273.53 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | N-butyl-1-ethylsulfanyl-3-methyl-N-propylhexan-1-amine |
| SMILES | CCCCN(CCC)C(CC(C)CCC)SCC |
| InChI | InChI=1S/C16H35NS/c1-6-10-13-17(12-8-3)16(18-9-4)14-15(5)11-7-2/h15-16H,6-14H2,1-5H3 |
| InChIKey | KHRHGRGRMZETTR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|