C10H23NS — CID 123172580
N,N,2-trimethyl-1-methylsulfanylhexan-1-amine (PubChem CID 123172580) has the molecular formula C10H23NS and a molecular weight of 189.37 g/mol. Its IUPAC name is N,N,2-trimethyl-1-methylsulfanylhexan-1-amine.
| Compound Name | N,N,2-trimethyl-1-methylsulfanylhexan-1-amine |
|---|---|
| PubChem CID | 123172580 |
| Molecular Formula | C10H23NS |
| Molecular Weight | 189.37 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | N,N,2-trimethyl-1-methylsulfanylhexan-1-amine |
| SMILES | CCCCC(C)C(SC)N(C)C |
| InChI | InChI=1S/C10H23NS/c1-6-7-8-9(2)10(12-5)11(3)4/h9-10H,6-8H2,1-5H3 |
| InChIKey | FZBKDPVJFDZWMG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|