C15H33NS — CID 123528253
N-(ethylsulfanylmethyl)-N,2,4-trimethylnonan-1-amine (PubChem CID 123528253) has the molecular formula C15H33NS and a molecular weight of 259.50 g/mol. Its IUPAC name is N-(ethylsulfanylmethyl)-N,2,4-trimethylnonan-1-amine.
| Compound Name | N-(ethylsulfanylmethyl)-N,2,4-trimethylnonan-1-amine |
|---|---|
| PubChem CID | 123528253 |
| Molecular Formula | C15H33NS |
| Molecular Weight | 259.50 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-(ethylsulfanylmethyl)-N,2,4-trimethylnonan-1-amine |
| SMILES | CCCCCC(C)CC(C)CN(C)CSCC |
| InChI | InChI=1S/C15H33NS/c1-6-8-9-10-14(3)11-15(4)12-16(5)13-17-7-2/h14-15H,6-13H2,1-5H3 |
| InChIKey | OVESRVMQKIZCKU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|