C13H15N6O2+ — CID 123725394
dihydroxy-methyl-[2-[(1-methylindazol-5-yl)amino]pyrimidin-4-yl]azanium (PubChem CID 123725394) has the molecular formula C13H15N6O2+ and a molecular weight of 287.30 g/mol. Its IUPAC name is dihydroxy-methyl-[2-[(1-methylindazol-5-yl)amino]pyrimidin-4-yl]azanium.
| Compound Name | dihydroxy-methyl-[2-[(1-methylindazol-5-yl)amino]pyrimidin-4-yl]azanium |
|---|---|
| PubChem CID | 123725394 |
| Molecular Formula | C13H15N6O2+ |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | dihydroxy-methyl-[2-[(1-methylindazol-5-yl)amino]pyrimidin-4-yl]azanium |
| SMILES | Cn1ncc2cc(Nc3nccc([N+](C)(O)O)n3)ccc21 |
| InChI | InChI=1S/C13H15N6O2/c1-18-11-4-3-10(7-9(11)8-15-18)16-13-14-6-5-12(17-13)19(2,20)21/h3-8,20-21H,1-2H3,(H,14,16,17)/q+1 |
| InChIKey | QVHZLDUPXRXDQH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|