C14H24O2 — CID 123725404
4-methyl-2-pentyl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine (PubChem CID 123725404) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 4-methyl-2-pentyl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine.
| Compound Name | 4-methyl-2-pentyl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 123725404 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 4-methyl-2-pentyl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine |
| SMILES | CCCCCC1OC(C)C2CCC=CC2O1 |
| InChI | InChI=1S/C14H24O2/c1-3-4-5-10-14-15-11(2)12-8-6-7-9-13(12)16-14/h7,9,11-14H,3-6,8,10H2,1-2H3 |
| InChIKey | GJXSXHBACBGQJK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|