C16H19FN2O3 — CID 123726631
ethyl N-[(E)-5-[(4-fluorobenzoyl)amino]hex-4-en-3-ylidene]carbamate (PubChem CID 123726631) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is ethyl N-[(E)-5-[(4-fluorobenzoyl)amino]hex-4-en-3-ylidene]carbamate.
| Compound Name | ethyl N-[(E)-5-[(4-fluorobenzoyl)amino]hex-4-en-3-ylidene]carbamate |
|---|---|
| PubChem CID | 123726631 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | ethyl N-[(E)-5-[(4-fluorobenzoyl)amino]hex-4-en-3-ylidene]carbamate |
| SMILES | CCOC(=O)N=C(/C=C(\C)NC(=O)c1ccc(F)cc1)CC |
| InChI | InChI=1S/C16H19FN2O3/c1-4-14(19-16(21)22-5-2)10-11(3)18-15(20)12-6-8-13(17)9-7-12/h6-10H,4-5H2,1-3H3,(H,18,20)/b11-10+,19-14? |
| InChIKey | WNEUJUUIOUJWOT-VRAKUTNOSA-N |
| XLogP | 3.47 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|