C20H20F2N2O2 — CID 91547514
N-cyclohepta-1,3,6-trien-1-yl-4-(5,5-difluoro-3-oxohexanimidoyl)benzamide (PubChem CID 91547514) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is N-cyclohepta-1,3,6-trien-1-yl-4-(5,5-difluoro-3-oxohexanimidoyl)benzamide.
| Compound Name | N-cyclohepta-1,3,6-trien-1-yl-4-(5,5-difluoro-3-oxohexanimidoyl)benzamide |
|---|---|
| PubChem CID | 91547514 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-cyclohepta-1,3,6-trien-1-yl-4-(5,5-difluoro-3-oxohexanimidoyl)benzamide |
| SMILES | [H]/N=C(\CC(=O)CC(C)(F)F)c1ccc(C(=O)NC2=CC=CCC=C2)cc1 |
| InChI | InChI=1S/C20H20F2N2O2/c1-20(21,22)13-17(25)12-18(23)14-8-10-15(11-9-14)19(26)24-16-6-4-2-3-5-7-16/h2,4-11,23H,3,12-13H2,1H3,(H,24,26)/b23-18+ |
| InChIKey | ZCULPNUILULRMK-PTGBLXJZSA-N |
| XLogP | 4.19 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|