C17H21FN2O3 — CID 123966314
ethyl N-[(E)-5-[(4-fluorobenzoyl)amino]hept-4-en-3-ylidene]carbamate (PubChem CID 123966314) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is ethyl N-[(E)-5-[(4-fluorobenzoyl)amino]hept-4-en-3-ylidene]carbamate.
| Compound Name | ethyl N-[(E)-5-[(4-fluorobenzoyl)amino]hept-4-en-3-ylidene]carbamate |
|---|---|
| PubChem CID | 123966314 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | ethyl N-[(E)-5-[(4-fluorobenzoyl)amino]hept-4-en-3-ylidene]carbamate |
| SMILES | CCOC(=O)N=C(/C=C(\CC)NC(=O)c1ccc(F)cc1)CC |
| InChI | InChI=1S/C17H21FN2O3/c1-4-14(11-15(5-2)20-17(22)23-6-3)19-16(21)12-7-9-13(18)10-8-12/h7-11H,4-6H2,1-3H3,(H,19,21)/b14-11+,20-15? |
| InChIKey | ZWMUQVVFPDUFHM-AWZDPBBESA-N |
| XLogP | 3.86 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|