C29H25FN4O5 — CID 123726903
N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(4-fluorophenyl)-1-methyl-4-oxo-2H-pyrimidine-5-carboxamide (PubChem CID 123726903) has the molecular formula C29H25FN4O5 and a molecular weight of 528.54 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(4-fluorophenyl)-1-methyl-4-oxo-2H-pyrimidine-5-carboxamide.
| Compound Name | N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(4-fluorophenyl)-1-methyl-4-oxo-2H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123726903 |
| Molecular Formula | C29H25FN4O5 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(4-fluorophenyl)-1-methyl-4-oxo-2H-pyrimidine-5-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4=CN(C)CN(c5ccc(F)cc5)C4=O)cc3)c2cc1OC |
| InChI | InChI=1S/C29H25FN4O5/c1-33-16-23(29(36)34(17-33)20-8-4-18(30)5-9-20)28(35)32-19-6-10-21(11-7-19)39-25-12-13-31-24-15-27(38-3)26(37-2)14-22(24)25/h4-16H,17H2,1-3H3,(H,32,35) |
| InChIKey | SXISLNMCBDGVLD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|