About 7-phenylpyrano[2,3-d]pyrimidin-5-one
7-phenylpyrano[2,3-d]pyrimidin-5-one (PubChem CID 123727420) has the molecular formula C13H8N2O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 7-phenylpyrano[2,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-phenylpyrano[2,3-d]pyrimidin-5-one |
| PubChem CID | 123727420 |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 7-phenylpyrano[2,3-d]pyrimidin-5-one |
| SMILES | O=c1cc(-c2ccccc2)oc2ncncc12 |
| InChI | InChI=1S/C13H8N2O2/c16-11-6-12(9-4-2-1-3-5-9)17-13-10(11)7-14-8-15-13/h1-8H |
| InChIKey | AAUHZVVDULWYAH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-phenylpyrano[2,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylpyrano[2,3-d]pyrimidin-5-one?
The IUPAC name of 7-phenylpyrano[2,3-d]pyrimidin-5-one (CID 123727420) is 7-phenylpyrano[2,3-d]pyrimidin-5-one.
What is the SMILES notation for 7-phenylpyrano[2,3-d]pyrimidin-5-one?
The canonical SMILES for 7-phenylpyrano[2,3-d]pyrimidin-5-one is O=c1cc(-c2ccccc2)oc2ncncc12.
What is the InChIKey of 7-phenylpyrano[2,3-d]pyrimidin-5-one?
The InChIKey is AAUHZVVDULWYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2/c16-11-6-12(9-4-2-1-3-5-9)17-13-10(11)7-14-8-15-13/h1-8H.
What are the key properties of 7-phenylpyrano[2,3-d]pyrimidin-5-one?
7-phenylpyrano[2,3-d]pyrimidin-5-one has a molecular weight of 224.22 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylpyrano[2,3-d]pyrimidin-5-one is sourced from PubChem (CID 123727420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).