About 5-methyliminopentanoyl chloride
5-methyliminopentanoyl chloride (PubChem CID 123728078) has the molecular formula C6H10ClNO
and a molecular weight of 147.60 g/mol. Its IUPAC name is 5-methyliminopentanoyl chloride.
Molecular Properties
| Compound Name | 5-methyliminopentanoyl chloride |
| PubChem CID | 123728078 |
| Molecular Formula | C6H10ClNO |
| Molecular Weight | 147.60 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 5-methyliminopentanoyl chloride |
| SMILES | C/N=C/CCCC(=O)Cl |
| InChI | InChI=1S/C6H10ClNO/c1-8-5-3-2-4-6(7)9/h5H,2-4H2,1H3/b8-5+ |
| InChIKey | DLCBHRPYAVWIKT-VMPITWQZSA-N |
| XLogP | 1.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.60 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyliminopentanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyliminopentanoyl chloride?
The IUPAC name of 5-methyliminopentanoyl chloride (CID 123728078) is 5-methyliminopentanoyl chloride.
What is the SMILES notation for 5-methyliminopentanoyl chloride?
The canonical SMILES for 5-methyliminopentanoyl chloride is C/N=C/CCCC(=O)Cl.
What is the InChIKey of 5-methyliminopentanoyl chloride?
The InChIKey is DLCBHRPYAVWIKT-VMPITWQZSA-N. The full InChI is InChI=1S/C6H10ClNO/c1-8-5-3-2-4-6(7)9/h5H,2-4H2,1H3/b8-5+.
What are the key properties of 5-methyliminopentanoyl chloride?
5-methyliminopentanoyl chloride has a molecular weight of 147.60 g/mol, XLogP of 1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyliminopentanoyl chloride is sourced from PubChem (CID 123728078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).