C13H16N2 — CID 123729667
6-ethenyl-3-ethyl-1-methyl-8aH-cinnoline (PubChem CID 123729667) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 6-ethenyl-3-ethyl-1-methyl-8aH-cinnoline.
| Compound Name | 6-ethenyl-3-ethyl-1-methyl-8aH-cinnoline |
|---|---|
| PubChem CID | 123729667 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 6-ethenyl-3-ethyl-1-methyl-8aH-cinnoline |
| SMILES | C=CC1=CC2=CC(CC)=NN(C)C2C=C1 |
| InChI | InChI=1S/C13H16N2/c1-4-10-6-7-13-11(8-10)9-12(5-2)14-15(13)3/h4,6-9,13H,1,5H2,2-3H3 |
| InChIKey | JEBWKSOXXBVCNL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |