C11H18N2 — CID 90787896
1,3-dimethyl-5,7a-dihydroindazole;ethane (PubChem CID 90787896) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1,3-dimethyl-5,7a-dihydroindazole;ethane.
| Compound Name | 1,3-dimethyl-5,7a-dihydroindazole;ethane |
|---|---|
| PubChem CID | 90787896 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1,3-dimethyl-5,7a-dihydroindazole;ethane |
| SMILES | CC.CC1=NN(C)C2C=CCC=C12 |
| InChI | InChI=1S/C9H12N2.C2H6/c1-7-8-5-3-4-6-9(8)11(2)10-7;1-2/h4-6,9H,3H2,1-2H3;1-2H3 |
| InChIKey | WJHKYLPZZMZFPZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|